C23H32N4O — CID 135871019
2-cyclohexylimino-3,5,14-triazatetracyclo[12.2.2.26,9.01,5]icosa-6(20),7,9(19)-trien-4-one (PubChem CID 135871019) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-cyclohexylimino-3,5,14-triazatetracyclo[12.2.2.26,9.01,5]icosa-6(20),7,9(19)-trien-4-one.
| Compound Name | 2-cyclohexylimino-3,5,14-triazatetracyclo[12.2.2.26,9.01,5]icosa-6(20),7,9(19)-trien-4-one |
|---|---|
| PubChem CID | 135871019 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 2-cyclohexylimino-3,5,14-triazatetracyclo[12.2.2.26,9.01,5]icosa-6(20),7,9(19)-trien-4-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)C23CCN(CCCCc4ccc(cc4)N12)CC3 |
| InChI | InChI=1S/C23H32N4O/c28-22-25-21(24-19-7-2-1-3-8-19)23-13-16-26(17-14-23)15-5-4-6-18-9-11-20(12-10-18)27(22)23/h9-12,19H,1-8,13-17H2,(H,24,25,28) |
| InChIKey | RZURVMFQIZPUEZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|