About 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride
1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride (PubChem CID 44531005) has the molecular formula C21H25ClN6O
and a molecular weight of 412.93 g/mol. Its IUPAC name is 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride.
Molecular Properties
| Compound Name | 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride |
| PubChem CID | 44531005 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride |
| SMILES | CN1CCN=C1c1ccc(NC(=O)Nc2ccc(C3=NCCN3C)cc2)cc1.Cl |
| InChI | InChI=1S/C21H24N6O.ClH/c1-26-13-11-22-19(26)15-3-7-17(8-4-15)24-21(28)25-18-9-5-16(6-10-18)20-23-12-14-27(20)2;/h3-10H,11-14H2,1-2H3,(H2,24,25,28);1H |
| InChIKey | VFLWFQVABLZVHK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride?
The IUPAC name of 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride (CID 44531005) is 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride.
What is the SMILES notation for 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride?
The canonical SMILES for 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride is CN1CCN=C1c1ccc(NC(=O)Nc2ccc(C3=NCCN3C)cc2)cc1.Cl.
What is the InChIKey of 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride?
The InChIKey is VFLWFQVABLZVHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N6O.ClH/c1-26-13-11-22-19(26)15-3-7-17(8-4-15)24-21(28)25-18-9-5-16(6-10-18)20-23-12-14-27(20)2;/h3-10H,11-14H2,1-2H3,(H2,24,25,28);1H.
What are the key properties of 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride?
1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride has a molecular weight of 412.93 g/mol, XLogP of 3.14, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]urea;hydrochloride is sourced from PubChem (CID 44531005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).