C22H26N4O4S — CID 134788645
CID 134788645 (PubChem CID 134788645) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol.
| Compound Name | CID 134788645 |
|---|---|
| PubChem CID | 134788645 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | — |
| SMILES | CCc1nc2c(c(-c3ccc(OC)cc3)n1)CCN([S+](=O)([O-])c1c(C)noc1C)CC2 |
| InChI | InChI=1S/C22H26N4O4S/c1-5-20-23-19-11-13-26(31(27,28)22-14(2)25-30-15(22)3)12-10-18(19)21(24-20)16-6-8-17(29-4)9-7-16/h6-9H,5,10-13H2,1-4H3 |
| InChIKey | BKPVBODHXZPZGN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 104.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|