C20H20N2O4 — CID 134795655
1'-(4-methoxybenzoyl)spiro[3H-1,3-benzoxazine-2,3'-piperidine]-4-one (PubChem CID 134795655) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1'-(4-methoxybenzoyl)spiro[3H-1,3-benzoxazine-2,3'-piperidine]-4-one.
| Compound Name | 1'-(4-methoxybenzoyl)spiro[3H-1,3-benzoxazine-2,3'-piperidine]-4-one |
|---|---|
| PubChem CID | 134795655 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1'-(4-methoxybenzoyl)spiro[3H-1,3-benzoxazine-2,3'-piperidine]-4-one |
| SMILES | COc1ccc(C(=O)N2CCCC3(C2)NC(=O)c2ccccc2O3)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-25-15-9-7-14(8-10-15)19(24)22-12-4-11-20(13-22)21-18(23)16-5-2-3-6-17(16)26-20/h2-3,5-10H,4,11-13H2,1H3,(H,21,23) |
| InChIKey | ZNCLRCUVZCGTLP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |