C23H23ClN2OS — CID 134797827
3-chloro-N-[1-[(3-thiophen-2-ylphenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 134797827) has the molecular formula C23H23ClN2OS and a molecular weight of 410.97 g/mol. Its IUPAC name is 3-chloro-N-[1-[(3-thiophen-2-ylphenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 3-chloro-N-[1-[(3-thiophen-2-ylphenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 134797827 |
| Molecular Formula | C23H23ClN2OS |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 3-chloro-N-[1-[(3-thiophen-2-ylphenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(Cc2cccc(-c3cccs3)c2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H23ClN2OS/c24-20-7-2-6-19(15-20)23(27)25-21-9-11-26(12-10-21)16-17-4-1-5-18(14-17)22-8-3-13-28-22/h1-8,13-15,21H,9-12,16H2,(H,25,27) |
| InChIKey | FPEFZMHNGFDHBM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |