C26H26ClN3OS — CID 53023077
N-(1-benzylpiperidin-4-yl)-2-(5-chloro-2-thiophen-2-ylindol-1-yl)acetamide (PubChem CID 53023077) has the molecular formula C26H26ClN3OS and a molecular weight of 464.03 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-(5-chloro-2-thiophen-2-ylindol-1-yl)acetamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-(5-chloro-2-thiophen-2-ylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 53023077 |
| Molecular Formula | C26H26ClN3OS |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(5-chloro-2-thiophen-2-ylindol-1-yl)acetamide |
| SMILES | O=C(Cn1c(-c2cccs2)cc2cc(Cl)ccc21)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H26ClN3OS/c27-21-8-9-23-20(15-21)16-24(25-7-4-14-32-25)30(23)18-26(31)28-22-10-12-29(13-11-22)17-19-5-2-1-3-6-19/h1-9,14-16,22H,10-13,17-18H2,(H,28,31) |
| InChIKey | VKNAWWANJJYIOO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |