About ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate
ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate (PubChem CID 13479938) has the molecular formula C7H10N4O2S
and a molecular weight of 214.25 g/mol. Its IUPAC name is ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate.
Analyze ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate?
The IUPAC name of ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate (CID 13479938) is ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate.
What is the SMILES notation for ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate?
The canonical SMILES for ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate is CCOC(=O)c1nnc(SC)nc1N.
What is the InChIKey of ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate?
The InChIKey is XJCBTOVGYMXJDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2S/c1-3-13-6(12)4-5(8)9-7(14-2)11-10-4/h3H2,1-2H3,(H2,8,9,11).
What are the key properties of ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate?
ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate has a molecular weight of 214.25 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-3-methylsulfanyl-1,2,4-triazine-6-carboxylate is sourced from PubChem (CID 13479938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).