C12H20N4O2S — CID 168916827
ethyl 4-amino-6-(butylamino)-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 168916827) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is ethyl 4-amino-6-(butylamino)-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-6-(butylamino)-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 168916827 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl 4-amino-6-(butylamino)-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCCCNc1nc(SC)nc(N)c1C(=O)OCC |
| InChI | InChI=1S/C12H20N4O2S/c1-4-6-7-14-10-8(11(17)18-5-2)9(13)15-12(16-10)19-3/h4-7H2,1-3H3,(H3,13,14,15,16) |
| InChIKey | OECFKBGJRZROAX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|