C15H22N4O2 — CID 91605500
ethyl 4-(butylamino)-6-ethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 91605500) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is ethyl 4-(butylamino)-6-ethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-(butylamino)-6-ethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 91605500 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | ethyl 4-(butylamino)-6-ethyl-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCCCNc1c(C(=O)OCC)c(CC)nc2[nH]ncc12 |
| InChI | InChI=1S/C15H22N4O2/c1-4-7-8-16-13-10-9-17-19-14(10)18-11(5-2)12(13)15(20)21-6-3/h9H,4-8H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | YGXPBZXBIYCJKB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|