C20H23ClN2O2 — CID 134799821
methyl 4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 134799821) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is methyl 4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134799821 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl 4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(Cc2ccccc2-c2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-15-7-8-16(13-19(15)21)18-6-4-3-5-17(18)14-22-9-11-23(12-10-22)20(24)25-2/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | UNXZSGUCHGVBNX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |