C26H27ClN2OS — CID 134801209
2-chloro-N-[1-[[3-(4-methylsulfanylphenyl)phenyl]methyl]piperidin-4-yl]benzamide (PubChem CID 134801209) has the molecular formula C26H27ClN2OS and a molecular weight of 451.04 g/mol. Its IUPAC name is 2-chloro-N-[1-[[3-(4-methylsulfanylphenyl)phenyl]methyl]piperidin-4-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[[3-(4-methylsulfanylphenyl)phenyl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 134801209 |
| Molecular Formula | C26H27ClN2OS |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-chloro-N-[1-[[3-(4-methylsulfanylphenyl)phenyl]methyl]piperidin-4-yl]benzamide |
| SMILES | CSc1ccc(-c2cccc(CN3CCC(NC(=O)c4ccccc4Cl)CC3)c2)cc1 |
| InChI | InChI=1S/C26H27ClN2OS/c1-31-23-11-9-20(10-12-23)21-6-4-5-19(17-21)18-29-15-13-22(14-16-29)28-26(30)24-7-2-3-8-25(24)27/h2-12,17,22H,13-16,18H2,1H3,(H,28,30) |
| InChIKey | UYTXSYUPGVPGAP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |