C22H22N4O3S2 — CID 134801744
CID 134801744 (PubChem CID 134801744) has the molecular formula C22H22N4O3S2 and a molecular weight of 454.58 g/mol.
| Compound Name | CID 134801744 |
|---|---|
| PubChem CID | 134801744 |
| Molecular Formula | C22H22N4O3S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | — |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(C1CC1)N(C1CN([S+](=O)([O-])c3cccs3)C1)C2=O |
| InChI | InChI=1S/C22H22N4O3S2/c1-14-19-20(15-9-10-15)25(17-12-24(13-17)31(28,29)18-8-5-11-30-18)22(27)21(19)26(23-14)16-6-3-2-4-7-16/h2-8,11,15,17,20H,9-10,12-13H2,1H3 |
| InChIKey | BLJDUZZKRKHAIZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|