C21H22N2O2S2 — CID 134803031
CID 134803031 (PubChem CID 134803031) has the molecular formula C21H22N2O2S2 and a molecular weight of 398.55 g/mol.
| Compound Name | CID 134803031 |
|---|---|
| PubChem CID | 134803031 |
| Molecular Formula | C21H22N2O2S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(NC1CCN(Cc2ccc(-c3ccsc3)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2S2/c24-27(25,21-4-2-1-3-5-21)22-20-10-12-23(15-20)14-17-6-8-18(9-7-17)19-11-13-26-16-19/h1-9,11,13,16,20H,10,12,14-15H2,(H-,22,24,25) |
| InChIKey | JSLUKMCNCFIUNT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|