C27H29F3N2O2S — CID 134803999
CID 134803999 (PubChem CID 134803999) has the molecular formula C27H29F3N2O2S and a molecular weight of 502.60 g/mol.
| Compound Name | CID 134803999 |
|---|---|
| PubChem CID | 134803999 |
| Molecular Formula | C27H29F3N2O2S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)cc(-c2ccc(CN3CCCC(N[S+](=O)([O-])c4cccc(C(F)(F)F)c4)C3)cc2)c1 |
| InChI | InChI=1S/C27H29F3N2O2S/c1-19-13-20(2)15-23(14-19)22-10-8-21(9-11-22)17-32-12-4-6-25(18-32)31-35(33,34)26-7-3-5-24(16-26)27(28,29)30/h3,5,7-11,13-16,25H,4,6,12,17-18H2,1-2H3,(H-,31,33,34) |
| InChIKey | AJBFAYLUKGAMGD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|