C25H24F4N2O3S — CID 134801178
CID 134801178 (PubChem CID 134801178) has the molecular formula C25H24F4N2O3S and a molecular weight of 508.54 g/mol.
| Compound Name | CID 134801178 |
|---|---|
| PubChem CID | 134801178 |
| Molecular Formula | C25H24F4N2O3S |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | — |
| SMILES | COc1ccc(F)cc1-c1ccc(CN2CCC(N[S+](=O)([O-])c3cccc(C(F)(F)F)c3)C2)cc1 |
| InChI | InChI=1S/C25H24F4N2O3S/c1-34-24-10-9-20(26)14-23(24)18-7-5-17(6-8-18)15-31-12-11-21(16-31)30-35(32,33)22-4-2-3-19(13-22)25(27,28)29/h2-10,13-14,21H,11-12,15-16H2,1H3,(H-,30,32,33) |
| InChIKey | SGMVJURGOUPMBH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|