C24H28ClN3O3S — CID 134802766
CID 134802766 (PubChem CID 134802766) has the molecular formula C24H28ClN3O3S and a molecular weight of 474.03 g/mol.
| Compound Name | CID 134802766 |
|---|---|
| PubChem CID | 134802766 |
| Molecular Formula | C24H28ClN3O3S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2cccc(CN3CCCC(N[S+](=O)([O-])c4c(C)noc4C)C3)c2)cc1Cl |
| InChI | InChI=1S/C24H28ClN3O3S/c1-16-9-10-21(13-23(16)25)20-7-4-6-19(12-20)14-28-11-5-8-22(15-28)27-32(29,30)24-17(2)26-31-18(24)3/h4,6-7,9-10,12-13,22H,5,8,11,14-15H2,1-3H3,(H-,27,29,30) |
| InChIKey | ZCFIYNHCVPCOGC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|