C22H39N5O2 — CID 134804510
N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]acetamide (PubChem CID 134804510) has the molecular formula C22H39N5O2 and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]acetamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]acetamide |
|---|---|
| PubChem CID | 134804510 |
| Molecular Formula | C22H39N5O2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-2-[(2R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]acetamide |
| SMILES | CCN1CCN(CCCNC(=O)CN2CC3CC(C2)[C@H]2CCCC(=O)N2C3)CC1 |
| InChI | InChI=1S/C22H39N5O2/c1-2-24-9-11-25(12-10-24)8-4-7-23-21(28)17-26-14-18-13-19(16-26)20-5-3-6-22(29)27(20)15-18/h18-20H,2-17H2,1H3,(H,23,28)/t18?,19?,20-/m1/s1 |
| InChIKey | ZSXQTMFFHOFTBL-SOAGJPPSSA-N |
| XLogP | 0.46 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|