C17H38NP — CID 13480757
tributyl(2,2-dimethylpropylimino)-lambda5-phosphane (PubChem CID 13480757) has the molecular formula C17H38NP and a molecular weight of 287.47 g/mol. Its IUPAC name is tributyl(2,2-dimethylpropylimino)-lambda5-phosphane.
| Compound Name | tributyl(2,2-dimethylpropylimino)-lambda5-phosphane |
|---|---|
| PubChem CID | 13480757 |
| Molecular Formula | C17H38NP |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.27 |
| IUPAC Name | tributyl(2,2-dimethylpropylimino)-lambda5-phosphane |
| SMILES | CCCCP(CCCC)(CCCC)=NCC(C)(C)C |
| InChI | InChI=1S/C17H38NP/c1-7-10-13-19(14-11-8-2,15-12-9-3)18-16-17(4,5)6/h7-16H2,1-6H3 |
| InChIKey | HYFBDBAQOKODOH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|