C25H35N3O2 — CID 134807638
N-[2-(dimethylamino)ethyl]-N,3-dimethyl-3-(4-phenylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide (PubChem CID 134807638) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N,3-dimethyl-3-(4-phenylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N,3-dimethyl-3-(4-phenylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 134807638 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N,3-dimethyl-3-(4-phenylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide |
| SMILES | CN(C)CCN(C)C(=O)c1ccc2c(c1)NC(C)(CCCCc1ccccc1)CO2 |
| InChI | InChI=1S/C25H35N3O2/c1-25(15-9-8-12-20-10-6-5-7-11-20)19-30-23-14-13-21(18-22(23)26-25)24(29)28(4)17-16-27(2)3/h5-7,10-11,13-14,18,26H,8-9,12,15-17,19H2,1-4H3 |
| InChIKey | OEPRZNSLWXNUQO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|