C25H32FN3O3 — CID 134805801
N-[(3-fluorophenyl)methyl]-3-methyl-3-(4-morpholin-4-ylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide (PubChem CID 134805801) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3-methyl-3-(4-morpholin-4-ylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-3-methyl-3-(4-morpholin-4-ylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 134805801 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3-methyl-3-(4-morpholin-4-ylbutyl)-2,4-dihydro-1,4-benzoxazine-6-carboxamide |
| SMILES | CC1(CCCCN2CCOCC2)COc2ccc(C(=O)NCc3cccc(F)c3)cc2N1 |
| InChI | InChI=1S/C25H32FN3O3/c1-25(9-2-3-10-29-11-13-31-14-12-29)18-32-23-8-7-20(16-22(23)28-25)24(30)27-17-19-5-4-6-21(26)15-19/h4-8,15-16,28H,2-3,9-14,17-18H2,1H3,(H,27,30) |
| InChIKey | PJJISTGZLMETCW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|