C14H14ClF3N4O2 — CID 134808397
4-[3-[4-chloro-3-(trifluoromethyl)anilino]-1H-1,2,4-triazol-5-yl]oxan-4-ol (PubChem CID 134808397) has the molecular formula C14H14ClF3N4O2 and a molecular weight of 362.74 g/mol. Its IUPAC name is 4-[3-[4-chloro-3-(trifluoromethyl)anilino]-1H-1,2,4-triazol-5-yl]oxan-4-ol.
| Compound Name | 4-[3-[4-chloro-3-(trifluoromethyl)anilino]-1H-1,2,4-triazol-5-yl]oxan-4-ol |
|---|---|
| PubChem CID | 134808397 |
| Molecular Formula | C14H14ClF3N4O2 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-[3-[4-chloro-3-(trifluoromethyl)anilino]-1H-1,2,4-triazol-5-yl]oxan-4-ol |
| SMILES | OC1(c2nc(Nc3ccc(Cl)c(C(F)(F)F)c3)n[nH]2)CCOCC1 |
| InChI | InChI=1S/C14H14ClF3N4O2/c15-10-2-1-8(7-9(10)14(16,17)18)19-12-20-11(21-22-12)13(23)3-5-24-6-4-13/h1-2,7,23H,3-6H2,(H2,19,20,21,22) |
| InChIKey | NMCFCDUSSVZKSA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |