C34H42N4O4 — CID 134808587
(9S,12S)-12-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-4-methoxy-10-methyl-N-(3-methylbutyl)-11-oxo-2,10-diazatricyclo[12.2.2.13,7]nonadeca-1(16),3,5,7(19),14,17-hexaene-9-carboxamide (PubChem CID 134808587) has the molecular formula C34H42N4O4 and a molecular weight of 570.73 g/mol. Its IUPAC name is (9S,12S)-12-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-4-methoxy-10-methyl-N-(3-methylbutyl)-11-oxo-2,10-diazatricyclo[12.2.2.13,7]nonadeca-1(16),3,5,7(19),14,17-hexaene-9-carboxamide.
| Compound Name | (9S,12S)-12-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-4-methoxy-10-methyl-N-(3-methylbutyl)-11-oxo-2,10-diazatricyclo[12.2.2.13,7]nonadeca-1(16),3,5,7(19),14,17-hexaene-9-carboxamide |
|---|---|
| PubChem CID | 134808587 |
| Molecular Formula | C34H42N4O4 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | (9S,12S)-12-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-4-methoxy-10-methyl-N-(3-methylbutyl)-11-oxo-2,10-diazatricyclo[12.2.2.13,7]nonadeca-1(16),3,5,7(19),14,17-hexaene-9-carboxamide |
| SMILES | COc1ccc2cc1Nc1ccc(cc1)C[C@H](NCc1ccc3c(c1)CCO3)C(=O)N(C)[C@H](C(=O)NCCC(C)C)C2 |
| InChI | InChI=1S/C34H42N4O4/c1-22(2)13-15-35-33(39)30-20-24-7-12-32(41-4)28(19-24)37-27-9-5-23(6-10-27)18-29(34(40)38(30)3)36-21-25-8-11-31-26(17-25)14-16-42-31/h5-12,17,19,22,29-30,36-37H,13-16,18,20-21H2,1-4H3,(H,35,39)/t29-,30-/m0/s1 |
| InChIKey | HBONZJZKJRHSSE-KYJUHHDHSA-N |
| XLogP | 4.62 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|