C16H15N3O3 — CID 134808997
6-(3,4-dimethoxyphenyl)-3-methylpyrido[3,2-d]pyrimidin-4-one (PubChem CID 134808997) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-3-methylpyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 6-(3,4-dimethoxyphenyl)-3-methylpyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 134808997 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-3-methylpyrido[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(-c2ccc3ncn(C)c(=O)c3n2)cc1OC |
| InChI | InChI=1S/C16H15N3O3/c1-19-9-17-12-6-5-11(18-15(12)16(19)20)10-4-7-13(21-2)14(8-10)22-3/h4-9H,1-3H3 |
| InChIKey | NTUUUQUEBJJNAM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |