C22H19N3O3 — CID 134810809
3-benzyl-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-one (PubChem CID 134810809) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-benzyl-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 134810809 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 3-benzyl-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(-c2ccc3ncn(Cc4ccccc4)c(=O)c3n2)cc1OC |
| InChI | InChI=1S/C22H19N3O3/c1-27-19-11-8-16(12-20(19)28-2)17-9-10-18-21(24-17)22(26)25(14-23-18)13-15-6-4-3-5-7-15/h3-12,14H,13H2,1-2H3 |
| InChIKey | GZKBTTUFPSMBDR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |