C18H16N2O2 — CID 134811626
methyl 4-methylidene-5,5-diphenyl-1H-pyrazole-3-carboxylate (PubChem CID 134811626) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 4-methylidene-5,5-diphenyl-1H-pyrazole-3-carboxylate.
| Compound Name | methyl 4-methylidene-5,5-diphenyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 134811626 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | methyl 4-methylidene-5,5-diphenyl-1H-pyrazole-3-carboxylate |
| SMILES | C=C1C(C(=O)OC)=NNC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2/c1-13-16(17(21)22-2)19-20-18(13,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,20H,1H2,2H3 |
| InChIKey | CNYGRUXIYFORDQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |