C19H18N2O4 — CID 13017116
dimethyl 5,5-diphenyl-1,4-dihydropyrazole-3,4-dicarboxylate (PubChem CID 13017116) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is dimethyl 5,5-diphenyl-1,4-dihydropyrazole-3,4-dicarboxylate.
| Compound Name | dimethyl 5,5-diphenyl-1,4-dihydropyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 13017116 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | dimethyl 5,5-diphenyl-1,4-dihydropyrazole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=NNC(c2ccccc2)(c2ccccc2)C1C(=O)OC |
| InChI | InChI=1S/C19H18N2O4/c1-24-17(22)15-16(18(23)25-2)20-21-19(15,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15,21H,1-2H3 |
| InChIKey | MGPTZXQRFUHGHI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |