C16H18N2O2 — CID 162419321
pent-4-ynyl 5-methyl-5-phenyl-1,4-dihydropyrazole-3-carboxylate (PubChem CID 162419321) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is pent-4-ynyl 5-methyl-5-phenyl-1,4-dihydropyrazole-3-carboxylate.
| Compound Name | pent-4-ynyl 5-methyl-5-phenyl-1,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 162419321 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | pent-4-ynyl 5-methyl-5-phenyl-1,4-dihydropyrazole-3-carboxylate |
| SMILES | C#CCCCOC(=O)C1=NNC(C)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2O2/c1-3-4-8-11-20-15(19)14-12-16(2,18-17-14)13-9-6-5-7-10-13/h1,5-7,9-10,18H,4,8,11-12H2,2H3 |
| InChIKey | MUWBLLPDTIIBMY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|