C21H22N2O4 — CID 1036393
diethyl (4R)-5,5-diphenyl-1,4-dihydropyrazole-3,4-dicarboxylate (PubChem CID 1036393) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is diethyl (4R)-5,5-diphenyl-1,4-dihydropyrazole-3,4-dicarboxylate.
| Compound Name | diethyl (4R)-5,5-diphenyl-1,4-dihydropyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 1036393 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | diethyl (4R)-5,5-diphenyl-1,4-dihydropyrazole-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=NNC(c2ccccc2)(c2ccccc2)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C21H22N2O4/c1-3-26-19(24)17-18(20(25)27-4-2)22-23-21(17,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17,23H,3-4H2,1-2H3/t17-/m1/s1 |
| InChIKey | UFBGIOJISDMOII-QGZVFWFLSA-N |
| XLogP | 2.63 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |