C18H16N2O2 — CID 134811648
methyl 3-methyl-4,5-diphenylpyrazole-4-carboxylate (PubChem CID 134811648) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 3-methyl-4,5-diphenylpyrazole-4-carboxylate.
| Compound Name | methyl 3-methyl-4,5-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134811648 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | methyl 3-methyl-4,5-diphenylpyrazole-4-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)C(C)=NN=C1c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2/c1-13-18(17(21)22-2,15-11-7-4-8-12-15)16(20-19-13)14-9-5-3-6-10-14/h3-12H,1-2H3 |
| InChIKey | FNVCVFOMJOKIGP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |