C9H7ClN2 — CID 13481189
3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile (PubChem CID 13481189) has the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. Its IUPAC name is 3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile.
| Compound Name | 3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 13481189 |
| Molecular Formula | C9H7ClN2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 3-chloro-6,7-dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile |
| SMILES | N#Cc1c(Cl)ncc2c1CCC2 |
| InChI | InChI=1S/C9H7ClN2/c10-9-8(4-11)7-3-1-2-6(7)5-12-9/h5H,1-3H2 |
| InChIKey | FLEGGCQGXMOSQW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|