C11H15ClN2 — CID 124676933
(1R)-1-(3-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)ethanamine (PubChem CID 124676933) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is (1R)-1-(3-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)ethanamine.
| Compound Name | (1R)-1-(3-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)ethanamine |
|---|---|
| PubChem CID | 124676933 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1R)-1-(3-chloro-5,6,7,8-tetrahydroisoquinolin-4-yl)ethanamine |
| SMILES | C[C@@H](N)c1c(Cl)ncc2c1CCCC2 |
| InChI | InChI=1S/C11H15ClN2/c1-7(13)10-9-5-3-2-4-8(9)6-14-11(10)12/h6-7H,2-5,13H2,1H3/t7-/m1/s1 |
| InChIKey | AHHSILFATLQPKA-SSDOTTSWSA-N |
| XLogP | 2.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|