C16H17FN2 — CID 146613270
3-(2-fluoro-4-pyridinyl)-4-propan-2-yl-6,7-dihydro-5H-cyclopenta[c]pyridine (PubChem CID 146613270) has the molecular formula C16H17FN2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-(2-fluoro-4-pyridinyl)-4-propan-2-yl-6,7-dihydro-5H-cyclopenta[c]pyridine.
| Compound Name | 3-(2-fluoro-4-pyridinyl)-4-propan-2-yl-6,7-dihydro-5H-cyclopenta[c]pyridine |
|---|---|
| PubChem CID | 146613270 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-(2-fluoro-4-pyridinyl)-4-propan-2-yl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| SMILES | CC(C)c1c(-c2ccnc(F)c2)ncc2c1CCC2 |
| InChI | InChI=1S/C16H17FN2/c1-10(2)15-13-5-3-4-12(13)9-19-16(15)11-6-7-18-14(17)8-11/h6-10H,3-5H2,1-2H3 |
| InChIKey | XCVBSTFQQMEXRK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|