C18H21FN2 — CID 167358994
3-(2-fluoro-4-pyridinyl)-7,7-dimethyl-4-propan-2-yl-5,6-dihydrocyclopenta[c]pyridine (PubChem CID 167358994) has the molecular formula C18H21FN2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-(2-fluoro-4-pyridinyl)-7,7-dimethyl-4-propan-2-yl-5,6-dihydrocyclopenta[c]pyridine.
| Compound Name | 3-(2-fluoro-4-pyridinyl)-7,7-dimethyl-4-propan-2-yl-5,6-dihydrocyclopenta[c]pyridine |
|---|---|
| PubChem CID | 167358994 |
| Molecular Formula | C18H21FN2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-(2-fluoro-4-pyridinyl)-7,7-dimethyl-4-propan-2-yl-5,6-dihydrocyclopenta[c]pyridine |
| SMILES | CC(C)c1c(-c2ccnc(F)c2)ncc2c1CCC2(C)C |
| InChI | InChI=1S/C18H21FN2/c1-11(2)16-13-5-7-18(3,4)14(13)10-21-17(16)12-6-8-20-15(19)9-12/h6,8-11H,5,7H2,1-4H3 |
| InChIKey | QAIXYLBJYHOVGK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|