C12H11F2N3 — CID 171092559
5-fluoro-2-(2-fluoro-4-pyridinyl)-N,N-dimethylpyridin-3-amine (PubChem CID 171092559) has the molecular formula C12H11F2N3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-fluoro-2-(2-fluoro-4-pyridinyl)-N,N-dimethylpyridin-3-amine.
| Compound Name | 5-fluoro-2-(2-fluoro-4-pyridinyl)-N,N-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 171092559 |
| Molecular Formula | C12H11F2N3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 5-fluoro-2-(2-fluoro-4-pyridinyl)-N,N-dimethylpyridin-3-amine |
| SMILES | CN(C)c1cc(F)cnc1-c1ccnc(F)c1 |
| InChI | InChI=1S/C12H11F2N3/c1-17(2)10-6-9(13)7-16-12(10)8-3-4-15-11(14)5-8/h3-7H,1-2H3 |
| InChIKey | FENUTBFRTBOFAB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|