C7H12N4S — CID 13481192
5-amino-6-(propan-2-ylamino)-1H-pyrimidine-4-thione (PubChem CID 13481192) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 5-amino-6-(propan-2-ylamino)-1H-pyrimidine-4-thione.
| Compound Name | 5-amino-6-(propan-2-ylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 13481192 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-amino-6-(propan-2-ylamino)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Nc1[nH]cnc(=S)c1N |
| InChI | InChI=1S/C7H12N4S/c1-4(2)11-6-5(8)7(12)10-3-9-6/h3-4H,8H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | GRGLAOPUGTVIFJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|