C6H9N5S — CID 143435481
2-amino-8-methyl-3,7,8,9-tetrahydropurine-6-thione (PubChem CID 143435481) has the molecular formula C6H9N5S and a molecular weight of 183.24 g/mol. Its IUPAC name is 2-amino-8-methyl-3,7,8,9-tetrahydropurine-6-thione.
| Compound Name | 2-amino-8-methyl-3,7,8,9-tetrahydropurine-6-thione |
|---|---|
| PubChem CID | 143435481 |
| Molecular Formula | C6H9N5S |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-amino-8-methyl-3,7,8,9-tetrahydropurine-6-thione |
| SMILES | CC1Nc2[nH]c(N)nc(=S)c2N1 |
| InChI | InChI=1S/C6H9N5S/c1-2-8-3-4(9-2)10-6(7)11-5(3)12/h2,8H,1H3,(H4,7,9,10,11,12) |
| InChIKey | VEVQSGZDDACGSH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|