C7H11N5S — CID 58738799
2-amino-7,9-dimethyl-3,8-dihydropurine-6-thione (PubChem CID 58738799) has the molecular formula C7H11N5S and a molecular weight of 197.27 g/mol. Its IUPAC name is 2-amino-7,9-dimethyl-3,8-dihydropurine-6-thione.
| Compound Name | 2-amino-7,9-dimethyl-3,8-dihydropurine-6-thione |
|---|---|
| PubChem CID | 58738799 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-amino-7,9-dimethyl-3,8-dihydropurine-6-thione |
| SMILES | CN1CN(C)c2c1[nH]c(N)nc2=S |
| InChI | InChI=1S/C7H11N5S/c1-11-3-12(2)5-4(11)6(13)10-7(8)9-5/h3H2,1-2H3,(H3,8,9,10,13) |
| InChIKey | WROAXVGFSBVKPW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|