C9H15N5S — CID 20980232
2-amino-9-butyl-7,8-dihydro-3H-purine-6-thione (PubChem CID 20980232) has the molecular formula C9H15N5S and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-amino-9-butyl-7,8-dihydro-3H-purine-6-thione.
| Compound Name | 2-amino-9-butyl-7,8-dihydro-3H-purine-6-thione |
|---|---|
| PubChem CID | 20980232 |
| Molecular Formula | C9H15N5S |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-amino-9-butyl-7,8-dihydro-3H-purine-6-thione |
| SMILES | CCCCN1CNc2c1[nH]c(N)nc2=S |
| InChI | InChI=1S/C9H15N5S/c1-2-3-4-14-5-11-6-7(14)12-9(10)13-8(6)15/h11H,2-5H2,1H3,(H3,10,12,13,15) |
| InChIKey | HJQFDNOFCHFADQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|