C5H6N4S — CID 54495717
3,6,7,9-tetrahydropurine-8-thione (PubChem CID 54495717) has the molecular formula C5H6N4S and a molecular weight of 154.20 g/mol. Its IUPAC name is 3,6,7,9-tetrahydropurine-8-thione.
| Compound Name | 3,6,7,9-tetrahydropurine-8-thione |
|---|---|
| PubChem CID | 54495717 |
| Molecular Formula | C5H6N4S |
| Molecular Weight | 154.20 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 3,6,7,9-tetrahydropurine-8-thione |
| SMILES | S=c1[nH]c2c([nH]1)NC=NC2 |
| InChI | InChI=1S/C5H6N4S/c10-5-8-3-1-6-2-7-4(3)9-5/h2H,1H2,(H,6,7)(H2,8,9,10) |
| InChIKey | XYYBMIOTHOBIGT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|