C5H7N5S — CID 56607768
6-amino-1,3,4,7-tetrahydropurine-2-thione (PubChem CID 56607768) has the molecular formula C5H7N5S and a molecular weight of 169.21 g/mol. Its IUPAC name is 6-amino-1,3,4,7-tetrahydropurine-2-thione.
| Compound Name | 6-amino-1,3,4,7-tetrahydropurine-2-thione |
|---|---|
| PubChem CID | 56607768 |
| Molecular Formula | C5H7N5S |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 6-amino-1,3,4,7-tetrahydropurine-2-thione |
| SMILES | NC1=C2NC=NC2NC(=S)N1 |
| InChI | InChI=1S/C5H7N5S/c6-3-2-4(8-1-7-2)10-5(11)9-3/h1,4H,6H2,(H,7,8)(H2,9,10,11) |
| InChIKey | XORJRRMMCDPLAT-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|