C5H9N5 — CID 175854136
1,2,2,3,4,9-hexadeuteriopurin-6-amine (PubChem CID 175854136) has the molecular formula C5H9N5 and a molecular weight of 145.20 g/mol. Its IUPAC name is 1,2,2,3,4,9-hexadeuteriopurin-6-amine.
| Compound Name | 1,2,2,3,4,9-hexadeuteriopurin-6-amine |
|---|---|
| PubChem CID | 175854136 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1,2,2,3,4,9-hexadeuteriopurin-6-amine |
| SMILES | [2H]N1C(N)=C2N=CN([2H])C2([2H])N([2H])C1([2H])[2H] |
| InChI | InChI=1S/C5H9N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1,5,8,10H,2,6H2,(H,7,9)/i2D2,5D/hD3 |
| InChIKey | BXSXSCFZOGSIQZ-KFXACZONSA-N |
| XLogP | -1.78 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |