About 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine
1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 23262607) has the molecular formula C5H8N6
and a molecular weight of 152.16 g/mol. Its IUPAC name is 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine.
Analyze 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine (CID 23262607) is 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine is CN1N=NC2N=CNC(N)=C21.
What is the InChIKey of 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is OIIFXUBLBZLXNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6/c1-11-3-4(6)7-2-8-5(3)9-10-11/h2,5H,6H2,1H3,(H,7,8).
What are the key properties of 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine?
1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 152.16 g/mol, XLogP of -0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3a,6-dihydrotriazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 23262607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).