C7H11N5 — CID 5185850
9-ethyl-1,4-dihydropurin-6-amine (PubChem CID 5185850) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is 9-ethyl-1,4-dihydropurin-6-amine.
| Compound Name | 9-ethyl-1,4-dihydropurin-6-amine |
|---|---|
| PubChem CID | 5185850 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 9-ethyl-1,4-dihydropurin-6-amine |
| SMILES | CCN1C=NC2=C(N)NC=NC21 |
| InChI | InChI=1S/C7H11N5/c1-2-12-4-11-5-6(8)9-3-10-7(5)12/h3-4,7H,2,8H2,1H3,(H,9,10) |
| InChIKey | CVHGJJUNIQONAM-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |