C7H8FN5 — CID 137483626
N-[(4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-yl]methanimine (PubChem CID 137483626) has the molecular formula C7H8FN5 and a molecular weight of 181.17 g/mol. Its IUPAC name is N-[(4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-yl]methanimine.
| Compound Name | N-[(4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-yl]methanimine |
|---|---|
| PubChem CID | 137483626 |
| Molecular Formula | C7H8FN5 |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | N-[(4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-yl]methanimine |
| SMILES | C=NC1=C2NC=N[C@@H]2N(C)C(F)=N1 |
| InChI | InChI=1S/C7H8FN5/c1-9-5-4-6(11-3-10-4)13(2)7(8)12-5/h3,6H,1H2,2H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | JXRPGUXTBYTFPF-ZCFIWIBFSA-N |
| XLogP | 0.08 |
| TPSA | 52.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|