C10H9BrO5 — CID 134812639
(2S)-4-(2-bromo-3-hydroxyphenyl)-2-hydroxy-4-oxobutanoic acid (PubChem CID 134812639) has the molecular formula C10H9BrO5 and a molecular weight of 289.08 g/mol. Its IUPAC name is (2S)-4-(2-bromo-3-hydroxyphenyl)-2-hydroxy-4-oxobutanoic acid.
| Compound Name | (2S)-4-(2-bromo-3-hydroxyphenyl)-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134812639 |
| Molecular Formula | C10H9BrO5 |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | (2S)-4-(2-bromo-3-hydroxyphenyl)-2-hydroxy-4-oxobutanoic acid |
| SMILES | O=C(C[C@H](O)C(=O)O)c1cccc(O)c1Br |
| InChI | InChI=1S/C10H9BrO5/c11-9-5(2-1-3-6(9)12)7(13)4-8(14)10(15)16/h1-3,8,12,14H,4H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | PEUXFUJLAAOYII-QMMMGPOBSA-N |
| XLogP | 1.17 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |