C22H39NOSSi — CID 134813845
(3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-N-(2-thiophen-2-ylethyl)nona-1,4-dien-3-amine (PubChem CID 134813845) has the molecular formula C22H39NOSSi and a molecular weight of 393.71 g/mol. Its IUPAC name is (3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-N-(2-thiophen-2-ylethyl)nona-1,4-dien-3-amine.
| Compound Name | (3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-N-(2-thiophen-2-ylethyl)nona-1,4-dien-3-amine |
|---|---|
| PubChem CID | 134813845 |
| Molecular Formula | C22H39NOSSi |
| Molecular Weight | 393.71 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | (3S,4Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-N-(2-thiophen-2-ylethyl)nona-1,4-dien-3-amine |
| SMILES | C=C[C@H](NCCc1cccs1)/C(=C/CCC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H39NOSSi/c1-9-20(23-16-15-19-13-11-17-25-19)21(14-10-12-18(2)3)24-26(7,8)22(4,5)6/h9,11,13-14,17-18,20,23H,1,10,12,15-16H2,2-8H3/b21-14-/t20-/m0/s1 |
| InChIKey | WXCARUICUUJYQY-RUAJRXAUSA-N |
| XLogP | 6.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.71 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|