C22H41NOSSi — CID 134813856
(Z,3S)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-N-(2-thiophen-2-ylethyl)non-4-en-3-amine (PubChem CID 134813856) has the molecular formula C22H41NOSSi and a molecular weight of 395.73 g/mol. Its IUPAC name is (Z,3S)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-N-(2-thiophen-2-ylethyl)non-4-en-3-amine.
| Compound Name | (Z,3S)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-N-(2-thiophen-2-ylethyl)non-4-en-3-amine |
|---|---|
| PubChem CID | 134813856 |
| Molecular Formula | C22H41NOSSi |
| Molecular Weight | 395.73 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | (Z,3S)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-N-(2-thiophen-2-ylethyl)non-4-en-3-amine |
| SMILES | CC[C@H](NCCc1cccs1)/C(=C/CCC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41NOSSi/c1-9-20(23-16-15-19-13-11-17-25-19)21(14-10-12-18(2)3)24-26(7,8)22(4,5)6/h11,13-14,17-18,20,23H,9-10,12,15-16H2,1-8H3/b21-14-/t20-/m0/s1 |
| InChIKey | XUEIJSDVVZRWTM-RUAJRXAUSA-N |
| XLogP | 7.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.73 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|