C22H18N4O3 — CID 134814219
1-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 134814219) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 134814219 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H18N4O3/c27-20-18-5-1-2-6-19(18)21(28)26(20)14-15-7-9-17(10-8-15)25-22(29)24-13-16-4-3-11-23-12-16/h1-12H,13-14H2,(H2,24,25,29) |
| InChIKey | KKBVILNJYCRNQY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|