C32H48O5 — CID 134815552
(E,4R,6R)-4-acetyloxy-2-methyl-6-[(5R,10S,13R,14S,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid (PubChem CID 134815552) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is (E,4R,6R)-4-acetyloxy-2-methyl-6-[(5R,10S,13R,14S,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid.
| Compound Name | (E,4R,6R)-4-acetyloxy-2-methyl-6-[(5R,10S,13R,14S,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 134815552 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | (E,4R,6R)-4-acetyloxy-2-methyl-6-[(5R,10S,13R,14S,17R)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,8,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
| SMILES | CC(=O)O[C@@H](/C=C(\C)C(=O)O)C[C@@H](C)[C@H]1CC[C@@]2(C)C3CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C32H48O5/c1-19(17-22(37-21(3)33)18-20(2)28(35)36)23-11-15-32(8)25-9-10-26-29(4,5)27(34)13-14-30(26,6)24(25)12-16-31(23,32)7/h12,18-19,22-23,25-26H,9-11,13-17H2,1-8H3,(H,35,36)/b20-18+/t19-,22-,23-,25?,26+,30-,31-,32+/m1/s1 |
| InChIKey | WOBOREWLFXLQAP-UNBJAHHZSA-N |
| XLogP | 7.15 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|