C30H44O5 — CID 162857226
(6R,7R)-7-[2-[(3S,3aR,5aR,9aS)-3,6,6,9a-tetramethyl-2,7-dioxo-3a,4,5,5a,8,9-hexahydrocyclopenta[a]naphthalen-3-yl]ethyl]-2,6-dimethyl-8-oxonon-2-enoic acid (PubChem CID 162857226) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (6R,7R)-7-[2-[(3S,3aR,5aR,9aS)-3,6,6,9a-tetramethyl-2,7-dioxo-3a,4,5,5a,8,9-hexahydrocyclopenta[a]naphthalen-3-yl]ethyl]-2,6-dimethyl-8-oxonon-2-enoic acid.
| Compound Name | (6R,7R)-7-[2-[(3S,3aR,5aR,9aS)-3,6,6,9a-tetramethyl-2,7-dioxo-3a,4,5,5a,8,9-hexahydrocyclopenta[a]naphthalen-3-yl]ethyl]-2,6-dimethyl-8-oxonon-2-enoic acid |
|---|---|
| PubChem CID | 162857226 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (6R,7R)-7-[2-[(3S,3aR,5aR,9aS)-3,6,6,9a-tetramethyl-2,7-dioxo-3a,4,5,5a,8,9-hexahydrocyclopenta[a]naphthalen-3-yl]ethyl]-2,6-dimethyl-8-oxonon-2-enoic acid |
| SMILES | CC(=O)[C@H](CC[C@]1(C)C(=O)C=C2[C@H]1CC[C@H]1C(C)(C)C(=O)CC[C@]21C)[C@H](C)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C30H44O5/c1-18(9-8-10-19(2)27(34)35)21(20(3)31)13-15-30(7)22-11-12-24-28(4,5)25(32)14-16-29(24,6)23(22)17-26(30)33/h10,17-18,21-22,24H,8-9,11-16H2,1-7H3,(H,34,35)/t18-,21-,22-,24+,29-,30+/m1/s1 |
| InChIKey | JELSBSFWZHKWLL-WMGCGDBWSA-N |
| XLogP | 6.36 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|